C9H10F6N2S — CID 103312764
[4,4,4-trifluoro-1-thiophen-2-yl-3-(trifluoromethyl)butan-2-yl]hydrazine (PubChem CID 103312764) has the molecular formula C9H10F6N2S and a molecular weight of 292.25 g/mol. Its IUPAC name is [4,4,4-trifluoro-1-thiophen-2-yl-3-(trifluoromethyl)butan-2-yl]hydrazine.
| Compound Name | [4,4,4-trifluoro-1-thiophen-2-yl-3-(trifluoromethyl)butan-2-yl]hydrazine |
|---|---|
| PubChem CID | 103312764 |
| Molecular Formula | C9H10F6N2S |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | [4,4,4-trifluoro-1-thiophen-2-yl-3-(trifluoromethyl)butan-2-yl]hydrazine |
| SMILES | NNC(Cc1cccs1)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H10F6N2S/c10-8(11,12)7(9(13,14)15)6(17-16)4-5-2-1-3-18-5/h1-3,6-7,17H,4,16H2 |
| InChIKey | GSDFSCWSBLIKOV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|