C13H12F3NS — CID 61077581
2-thiophen-2-yl-1-[3-(trifluoromethyl)phenyl]ethanamine (PubChem CID 61077581) has the molecular formula C13H12F3NS and a molecular weight of 271.31 g/mol. Its IUPAC name is 2-thiophen-2-yl-1-[3-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | 2-thiophen-2-yl-1-[3-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 61077581 |
| Molecular Formula | C13H12F3NS |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 2-thiophen-2-yl-1-[3-(trifluoromethyl)phenyl]ethanamine |
| SMILES | NC(Cc1cccs1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H12F3NS/c14-13(15,16)10-4-1-3-9(7-10)12(17)8-11-5-2-6-18-11/h1-7,12H,8,17H2 |
| InChIKey | DWUSCIXBFOMCDJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |