C11H18N2O2S2 — CID 105295494
[1-(1,1-dioxothiolan-3-yl)-3-thiophen-2-ylpropan-2-yl]hydrazine (PubChem CID 105295494) has the molecular formula C11H18N2O2S2 and a molecular weight of 274.41 g/mol. Its IUPAC name is [1-(1,1-dioxothiolan-3-yl)-3-thiophen-2-ylpropan-2-yl]hydrazine.
| Compound Name | [1-(1,1-dioxothiolan-3-yl)-3-thiophen-2-ylpropan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105295494 |
| Molecular Formula | C11H18N2O2S2 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | [1-(1,1-dioxothiolan-3-yl)-3-thiophen-2-ylpropan-2-yl]hydrazine |
| SMILES | NNC(Cc1cccs1)CC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H18N2O2S2/c12-13-10(7-11-2-1-4-16-11)6-9-3-5-17(14,15)8-9/h1-2,4,9-10,13H,3,5-8,12H2 |
| InChIKey | VBFNLXKWUPSYNF-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|