C10H18N2O2S — CID 105290634
1-(1,1-dioxothiolan-3-yl)hex-4-yn-2-ylhydrazine (PubChem CID 105290634) has the molecular formula C10H18N2O2S and a molecular weight of 230.33 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)hex-4-yn-2-ylhydrazine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)hex-4-yn-2-ylhydrazine |
|---|---|
| PubChem CID | 105290634 |
| Molecular Formula | C10H18N2O2S |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)hex-4-yn-2-ylhydrazine |
| SMILES | CC#CCC(CC1CCS(=O)(=O)C1)NN |
| InChI | InChI=1S/C10H18N2O2S/c1-2-3-4-10(12-11)7-9-5-6-15(13,14)8-9/h9-10,12H,4-8,11H2,1H3 |
| InChIKey | JCSJURNENWOACI-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|