C14H22N2O2S — CID 105292845
[2-(1,1-dioxothiolan-3-yl)-1-(4-ethylphenyl)ethyl]hydrazine (PubChem CID 105292845) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is [2-(1,1-dioxothiolan-3-yl)-1-(4-ethylphenyl)ethyl]hydrazine.
| Compound Name | [2-(1,1-dioxothiolan-3-yl)-1-(4-ethylphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105292845 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | [2-(1,1-dioxothiolan-3-yl)-1-(4-ethylphenyl)ethyl]hydrazine |
| SMILES | CCc1ccc(C(CC2CCS(=O)(=O)C2)NN)cc1 |
| InChI | InChI=1S/C14H22N2O2S/c1-2-11-3-5-13(6-4-11)14(16-15)9-12-7-8-19(17,18)10-12/h3-6,12,14,16H,2,7-10,15H2,1H3 |
| InChIKey | QAPHMWAEEDKTMJ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|