C16H25NO2S — CID 63923514
N-[1-(4-ethylphenyl)propyl]-1,1-dioxothian-3-amine (PubChem CID 63923514) has the molecular formula C16H25NO2S and a molecular weight of 295.45 g/mol. Its IUPAC name is N-[1-(4-ethylphenyl)propyl]-1,1-dioxothian-3-amine.
| Compound Name | N-[1-(4-ethylphenyl)propyl]-1,1-dioxothian-3-amine |
|---|---|
| PubChem CID | 63923514 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | N-[1-(4-ethylphenyl)propyl]-1,1-dioxothian-3-amine |
| SMILES | CCc1ccc(C(CC)NC2CCCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C16H25NO2S/c1-3-13-7-9-14(10-8-13)16(4-2)17-15-6-5-11-20(18,19)12-15/h7-10,15-17H,3-6,11-12H2,1-2H3 |
| InChIKey | ITNNULWEQCAWIN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |