C14H20BrNO2S — CID 63922699
N-[1-(3-bromophenyl)propyl]-1,1-dioxothian-3-amine (PubChem CID 63922699) has the molecular formula C14H20BrNO2S and a molecular weight of 346.29 g/mol. Its IUPAC name is N-[1-(3-bromophenyl)propyl]-1,1-dioxothian-3-amine.
| Compound Name | N-[1-(3-bromophenyl)propyl]-1,1-dioxothian-3-amine |
|---|---|
| PubChem CID | 63922699 |
| Molecular Formula | C14H20BrNO2S |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | N-[1-(3-bromophenyl)propyl]-1,1-dioxothian-3-amine |
| SMILES | CCC(NC1CCCS(=O)(=O)C1)c1cccc(Br)c1 |
| InChI | InChI=1S/C14H20BrNO2S/c1-2-14(11-5-3-6-12(15)9-11)16-13-7-4-8-19(17,18)10-13/h3,5-6,9,13-14,16H,2,4,7-8,10H2,1H3 |
| InChIKey | LOQLJTGVAMVPOH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |