C13H18BrNO2S — CID 81382661
N-[(1S)-1-(3-bromophenyl)ethyl]-1,1-dioxothian-3-amine (PubChem CID 81382661) has the molecular formula C13H18BrNO2S and a molecular weight of 332.26 g/mol. Its IUPAC name is N-[(1S)-1-(3-bromophenyl)ethyl]-1,1-dioxothian-3-amine.
| Compound Name | N-[(1S)-1-(3-bromophenyl)ethyl]-1,1-dioxothian-3-amine |
|---|---|
| PubChem CID | 81382661 |
| Molecular Formula | C13H18BrNO2S |
| Molecular Weight | 332.26 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | N-[(1S)-1-(3-bromophenyl)ethyl]-1,1-dioxothian-3-amine |
| SMILES | C[C@H](NC1CCCS(=O)(=O)C1)c1cccc(Br)c1 |
| InChI | InChI=1S/C13H18BrNO2S/c1-10(11-4-2-5-12(14)8-11)15-13-6-3-7-18(16,17)9-13/h2,4-5,8,10,13,15H,3,6-7,9H2,1H3/t10-,13?/m0/s1 |
| InChIKey | OZXAPBZPJCOJOD-NKUHCKNESA-N |
| XLogP | 2.68 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |