C13H17F2NO2S — CID 63922629
N-[1-(2,6-difluorophenyl)ethyl]-1,1-dioxothian-3-amine (PubChem CID 63922629) has the molecular formula C13H17F2NO2S and a molecular weight of 289.35 g/mol. Its IUPAC name is N-[1-(2,6-difluorophenyl)ethyl]-1,1-dioxothian-3-amine.
| Compound Name | N-[1-(2,6-difluorophenyl)ethyl]-1,1-dioxothian-3-amine |
|---|---|
| PubChem CID | 63922629 |
| Molecular Formula | C13H17F2NO2S |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-[1-(2,6-difluorophenyl)ethyl]-1,1-dioxothian-3-amine |
| SMILES | CC(NC1CCCS(=O)(=O)C1)c1c(F)cccc1F |
| InChI | InChI=1S/C13H17F2NO2S/c1-9(13-11(14)5-2-6-12(13)15)16-10-4-3-7-19(17,18)8-10/h2,5-6,9-10,16H,3-4,7-8H2,1H3 |
| InChIKey | XWHAMJSJETXMOM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |