C14H19F2NO2S — CID 75441562
1-(2,6-difluorophenyl)-N-[(1,1-dioxothian-4-yl)methyl]ethanamine (PubChem CID 75441562) has the molecular formula C14H19F2NO2S and a molecular weight of 303.37 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-N-[(1,1-dioxothian-4-yl)methyl]ethanamine.
| Compound Name | 1-(2,6-difluorophenyl)-N-[(1,1-dioxothian-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 75441562 |
| Molecular Formula | C14H19F2NO2S |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 1-(2,6-difluorophenyl)-N-[(1,1-dioxothian-4-yl)methyl]ethanamine |
| SMILES | CC(NCC1CCS(=O)(=O)CC1)c1c(F)cccc1F |
| InChI | InChI=1S/C14H19F2NO2S/c1-10(14-12(15)3-2-4-13(14)16)17-9-11-5-7-20(18,19)8-6-11/h2-4,10-11,17H,5-9H2,1H3 |
| InChIKey | UIVHBKKHZDXJGT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |