C14H19F2NO2S — CID 60942214
N-[1-(2,6-difluorophenyl)propan-2-yl]-1,1-dioxothian-4-amine (PubChem CID 60942214) has the molecular formula C14H19F2NO2S and a molecular weight of 303.37 g/mol. Its IUPAC name is N-[1-(2,6-difluorophenyl)propan-2-yl]-1,1-dioxothian-4-amine.
| Compound Name | N-[1-(2,6-difluorophenyl)propan-2-yl]-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 60942214 |
| Molecular Formula | C14H19F2NO2S |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | N-[1-(2,6-difluorophenyl)propan-2-yl]-1,1-dioxothian-4-amine |
| SMILES | CC(Cc1c(F)cccc1F)NC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C14H19F2NO2S/c1-10(9-12-13(15)3-2-4-14(12)16)17-11-5-7-20(18,19)8-6-11/h2-4,10-11,17H,5-9H2,1H3 |
| InChIKey | HIYYGZMSAKFWBL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |