C15H23NO2S — CID 43511639
1,1-dioxo-N-(4-phenylbutan-2-yl)thian-4-amine (PubChem CID 43511639) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is 1,1-dioxo-N-(4-phenylbutan-2-yl)thian-4-amine.
| Compound Name | 1,1-dioxo-N-(4-phenylbutan-2-yl)thian-4-amine |
|---|---|
| PubChem CID | 43511639 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 1,1-dioxo-N-(4-phenylbutan-2-yl)thian-4-amine |
| SMILES | CC(CCc1ccccc1)NC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C15H23NO2S/c1-13(7-8-14-5-3-2-4-6-14)16-15-9-11-19(17,18)12-10-15/h2-6,13,15-16H,7-12H2,1H3 |
| InChIKey | LCLWTHNBPQDRKI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |