C13H19NO3S — CID 114010168
(2S)-2-[(1,1-dioxothian-4-yl)amino]-2-phenylethanol (PubChem CID 114010168) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is (2S)-2-[(1,1-dioxothian-4-yl)amino]-2-phenylethanol.
| Compound Name | (2S)-2-[(1,1-dioxothian-4-yl)amino]-2-phenylethanol |
|---|---|
| PubChem CID | 114010168 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | (2S)-2-[(1,1-dioxothian-4-yl)amino]-2-phenylethanol |
| SMILES | O=S1(=O)CCC(N[C@H](CO)c2ccccc2)CC1 |
| InChI | InChI=1S/C13H19NO3S/c15-10-13(11-4-2-1-3-5-11)14-12-6-8-18(16,17)9-7-12/h1-5,12-15H,6-10H2/t13-/m1/s1 |
| InChIKey | YWOSHOXTXHRAAG-CYBMUJFWSA-N |
| XLogP | 0.89 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |