C17H27NO2S — CID 43740500
N-(3,3-dimethyl-1-phenylbutyl)-1,1-dioxothian-4-amine (PubChem CID 43740500) has the molecular formula C17H27NO2S and a molecular weight of 309.47 g/mol. Its IUPAC name is N-(3,3-dimethyl-1-phenylbutyl)-1,1-dioxothian-4-amine.
| Compound Name | N-(3,3-dimethyl-1-phenylbutyl)-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 43740500 |
| Molecular Formula | C17H27NO2S |
| Molecular Weight | 309.47 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | N-(3,3-dimethyl-1-phenylbutyl)-1,1-dioxothian-4-amine |
| SMILES | CC(C)(C)CC(NC1CCS(=O)(=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C17H27NO2S/c1-17(2,3)13-16(14-7-5-4-6-8-14)18-15-9-11-21(19,20)12-10-15/h4-8,15-16,18H,9-13H2,1-3H3 |
| InChIKey | KWOJUCWZMIXMMB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |