C12H17NO5S2 — CID 107863557
N-[(1S)-2-hydroxy-1-phenylethyl]-1,1-dioxothiolane-3-sulfonamide (PubChem CID 107863557) has the molecular formula C12H17NO5S2 and a molecular weight of 319.40 g/mol. Its IUPAC name is N-[(1S)-2-hydroxy-1-phenylethyl]-1,1-dioxothiolane-3-sulfonamide.
| Compound Name | N-[(1S)-2-hydroxy-1-phenylethyl]-1,1-dioxothiolane-3-sulfonamide |
|---|---|
| PubChem CID | 107863557 |
| Molecular Formula | C12H17NO5S2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | N-[(1S)-2-hydroxy-1-phenylethyl]-1,1-dioxothiolane-3-sulfonamide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)N[C@H](CO)c2ccccc2)C1 |
| InChI | InChI=1S/C12H17NO5S2/c14-8-12(10-4-2-1-3-5-10)13-20(17,18)11-6-7-19(15,16)9-11/h1-5,11-14H,6-9H2/t11?,12-/m1/s1 |
| InChIKey | VLUKBRZGDAKMSF-PIJUOVFKSA-N |
| XLogP | -0.17 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |