C7H15NO4S2 — CID 43827643
1,1-dioxo-N-propan-2-ylthiolane-3-sulfonamide (PubChem CID 43827643) has the molecular formula C7H15NO4S2 and a molecular weight of 241.33 g/mol. Its IUPAC name is 1,1-dioxo-N-propan-2-ylthiolane-3-sulfonamide.
| Compound Name | 1,1-dioxo-N-propan-2-ylthiolane-3-sulfonamide |
|---|---|
| PubChem CID | 43827643 |
| Molecular Formula | C7H15NO4S2 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 1,1-dioxo-N-propan-2-ylthiolane-3-sulfonamide |
| SMILES | CC(C)NS(=O)(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H15NO4S2/c1-6(2)8-14(11,12)7-3-4-13(9,10)5-7/h6-8H,3-5H2,1-2H3 |
| InChIKey | IAMWRISISBEXKX-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |