C8H17NO5S2 — CID 82715020
N-(2-methylpropoxy)-1,1-dioxothiolane-3-sulfonamide (PubChem CID 82715020) has the molecular formula C8H17NO5S2 and a molecular weight of 271.36 g/mol. Its IUPAC name is N-(2-methylpropoxy)-1,1-dioxothiolane-3-sulfonamide.
| Compound Name | N-(2-methylpropoxy)-1,1-dioxothiolane-3-sulfonamide |
|---|---|
| PubChem CID | 82715020 |
| Molecular Formula | C8H17NO5S2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | N-(2-methylpropoxy)-1,1-dioxothiolane-3-sulfonamide |
| SMILES | CC(C)CONS(=O)(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H17NO5S2/c1-7(2)5-14-9-16(12,13)8-3-4-15(10,11)6-8/h7-9H,3-6H2,1-2H3 |
| InChIKey | YDEYSSWKMZZHDU-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|