C7H13NO6S2 — CID 43624219
methyl 2-[(1,1-dioxothiolan-3-yl)sulfonylamino]acetate (PubChem CID 43624219) has the molecular formula C7H13NO6S2 and a molecular weight of 271.32 g/mol. Its IUPAC name is methyl 2-[(1,1-dioxothiolan-3-yl)sulfonylamino]acetate.
| Compound Name | methyl 2-[(1,1-dioxothiolan-3-yl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 43624219 |
| Molecular Formula | C7H13NO6S2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | methyl 2-[(1,1-dioxothiolan-3-yl)sulfonylamino]acetate |
| SMILES | COC(=O)CNS(=O)(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H13NO6S2/c1-14-7(9)4-8-16(12,13)6-2-3-15(10,11)5-6/h6,8H,2-5H2,1H3 |
| InChIKey | GOSJKKSDZDEUOJ-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |