C8H15NO7S2 — CID 114006725
4-[(1,1-dioxothiolan-3-yl)sulfonylamino]-2-hydroxybutanoic acid (PubChem CID 114006725) has the molecular formula C8H15NO7S2 and a molecular weight of 301.34 g/mol. Its IUPAC name is 4-[(1,1-dioxothiolan-3-yl)sulfonylamino]-2-hydroxybutanoic acid.
| Compound Name | 4-[(1,1-dioxothiolan-3-yl)sulfonylamino]-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 114006725 |
| Molecular Formula | C8H15NO7S2 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 4-[(1,1-dioxothiolan-3-yl)sulfonylamino]-2-hydroxybutanoic acid |
| SMILES | O=C(O)C(O)CCNS(=O)(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H15NO7S2/c10-7(8(11)12)1-3-9-18(15,16)6-2-4-17(13,14)5-6/h6-7,9-10H,1-5H2,(H,11,12) |
| InChIKey | WJDGWYJOCRMQCA-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 137.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |