4-[(1,1-dioxothiolan-3-yl)sulfonylamino]-2-hydroxybutanoic acid

C8H15NO7S2 — CID 114006725

IUPAC4-[(1,1-dioxothiolan-3-yl)sulfonylamino]-2-hydroxybutanoic acid
SMILESO=C(O)C(O)CCNS(=O)(=O)C1CCS(=O)(=O)C1
InChIInChI=1S/C8H15NO7S2/c10-7(8(11)12)1-3-9-18(15,16)6-2-4-17(13,14)5-6/h6-7,9-10H,1-5H2,(H,11,12)
InChIKeyWJDGWYJOCRMQCA-UHFFFAOYSA-N
MW301.34 g/mol
LogP-2.07
Rot. Bonds6

About 4-[(1,1-dioxothiolan-3-yl)sulfonylamino]-2-hydroxybutanoic acid

4-[(1,1-dioxothiolan-3-yl)sulfonylamino]-2-hydroxybutanoic acid (PubChem CID 114006725) has the molecular formula C8H15NO7S2 and a molecular weight of 301.34 g/mol. Its IUPAC name is 4-[(1,1-dioxothiolan-3-yl)sulfonylamino]-2-hydroxybutanoic acid.

Molecular Properties

Compound Name4-[(1,1-dioxothiolan-3-yl)sulfonylamino]-2-hydroxybutanoic acid
PubChem CID114006725
Molecular FormulaC8H15NO7S2
Molecular Weight301.34 g/mol
Exact Mass301.03
IUPAC Name4-[(1,1-dioxothiolan-3-yl)sulfonylamino]-2-hydroxybutanoic acid
SMILESO=C(O)C(O)CCNS(=O)(=O)C1CCS(=O)(=O)C1
InChIInChI=1S/C8H15NO7S2/c10-7(8(11)12)1-3-9-18(15,16)6-2-4-17(13,14)5-6/h6-7,9-10H,1-5H2,(H,11,12)
InChIKeyWJDGWYJOCRMQCA-UHFFFAOYSA-N
XLogP-2.07
TPSA137.84 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500301.34
LogP ≤ 5-2.07
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Analyze 4-[(1,1-dioxothiolan-3-yl)sulfonylamino]-2-hydroxybutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(1,1-dioxothiolan-3-yl)sulfonylamino]-2-hydroxybutanoic acid?
The IUPAC name of 4-[(1,1-dioxothiolan-3-yl)sulfonylamino]-2-hydroxybutanoic acid (CID 114006725) is 4-[(1,1-dioxothiolan-3-yl)sulfonylamino]-2-hydroxybutanoic acid.
What is the SMILES notation for 4-[(1,1-dioxothiolan-3-yl)sulfonylamino]-2-hydroxybutanoic acid?
The canonical SMILES for 4-[(1,1-dioxothiolan-3-yl)sulfonylamino]-2-hydroxybutanoic acid is O=C(O)C(O)CCNS(=O)(=O)C1CCS(=O)(=O)C1.
What is the InChIKey of 4-[(1,1-dioxothiolan-3-yl)sulfonylamino]-2-hydroxybutanoic acid?
The InChIKey is WJDGWYJOCRMQCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO7S2/c10-7(8(11)12)1-3-9-18(15,16)6-2-4-17(13,14)5-6/h6-7,9-10H,1-5H2,(H,11,12).
What are the key properties of 4-[(1,1-dioxothiolan-3-yl)sulfonylamino]-2-hydroxybutanoic acid?
4-[(1,1-dioxothiolan-3-yl)sulfonylamino]-2-hydroxybutanoic acid has a molecular weight of 301.34 g/mol, XLogP of -2.07, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1,1-dioxothiolan-3-yl)sulfonylamino]-2-hydroxybutanoic acid is sourced from PubChem (CID 114006725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).