C8H17NO5S2 — CID 43827633
N-(3-methoxypropyl)-1,1-dioxothiolane-3-sulfonamide (PubChem CID 43827633) has the molecular formula C8H17NO5S2 and a molecular weight of 271.36 g/mol. Its IUPAC name is N-(3-methoxypropyl)-1,1-dioxothiolane-3-sulfonamide.
| Compound Name | N-(3-methoxypropyl)-1,1-dioxothiolane-3-sulfonamide |
|---|---|
| PubChem CID | 43827633 |
| Molecular Formula | C8H17NO5S2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | N-(3-methoxypropyl)-1,1-dioxothiolane-3-sulfonamide |
| SMILES | COCCCNS(=O)(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H17NO5S2/c1-14-5-2-4-9-16(12,13)8-3-6-15(10,11)7-8/h8-9H,2-7H2,1H3 |
| InChIKey | ZCYZOGPVXUNFLK-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|