C11H22BrNO4S2 — CID 106158568
N-(5-bromo-4-methylpentyl)-1,1-dioxothiane-4-sulfonamide (PubChem CID 106158568) has the molecular formula C11H22BrNO4S2 and a molecular weight of 376.34 g/mol. Its IUPAC name is N-(5-bromo-4-methylpentyl)-1,1-dioxothiane-4-sulfonamide.
| Compound Name | N-(5-bromo-4-methylpentyl)-1,1-dioxothiane-4-sulfonamide |
|---|---|
| PubChem CID | 106158568 |
| Molecular Formula | C11H22BrNO4S2 |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | N-(5-bromo-4-methylpentyl)-1,1-dioxothiane-4-sulfonamide |
| SMILES | CC(CBr)CCCNS(=O)(=O)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H22BrNO4S2/c1-10(9-12)3-2-6-13-19(16,17)11-4-7-18(14,15)8-5-11/h10-11,13H,2-9H2,1H3 |
| InChIKey | HOVQDYRHAXOTFH-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|