C14H27NO5S2 — CID 127332273
N-(2-cycloheptyloxyethyl)-1,1-dioxothiane-4-sulfonamide (PubChem CID 127332273) has the molecular formula C14H27NO5S2 and a molecular weight of 353.51 g/mol. Its IUPAC name is N-(2-cycloheptyloxyethyl)-1,1-dioxothiane-4-sulfonamide.
| Compound Name | N-(2-cycloheptyloxyethyl)-1,1-dioxothiane-4-sulfonamide |
|---|---|
| PubChem CID | 127332273 |
| Molecular Formula | C14H27NO5S2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | N-(2-cycloheptyloxyethyl)-1,1-dioxothiane-4-sulfonamide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)NCCOC2CCCCCC2)CC1 |
| InChI | InChI=1S/C14H27NO5S2/c16-21(17)11-7-14(8-12-21)22(18,19)15-9-10-20-13-5-3-1-2-4-6-13/h13-15H,1-12H2 |
| InChIKey | YBTBPUZEBFJUDS-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|