C10H21NO5S3 — CID 103834756
N-[2-(3-hydroxypropylsulfanyl)ethyl]-1,1-dioxothiane-4-sulfonamide (PubChem CID 103834756) has the molecular formula C10H21NO5S3 and a molecular weight of 331.48 g/mol. Its IUPAC name is N-[2-(3-hydroxypropylsulfanyl)ethyl]-1,1-dioxothiane-4-sulfonamide.
| Compound Name | N-[2-(3-hydroxypropylsulfanyl)ethyl]-1,1-dioxothiane-4-sulfonamide |
|---|---|
| PubChem CID | 103834756 |
| Molecular Formula | C10H21NO5S3 |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | N-[2-(3-hydroxypropylsulfanyl)ethyl]-1,1-dioxothiane-4-sulfonamide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)NCCSCCCO)CC1 |
| InChI | InChI=1S/C10H21NO5S3/c12-5-1-6-17-7-4-11-19(15,16)10-2-8-18(13,14)9-3-10/h10-12H,1-9H2 |
| InChIKey | BNNQTSPIQGOUDS-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|