C11H21NO5S2 — CID 103270277
N-[(3-hydroxycyclopentyl)methyl]-1,1-dioxothiane-4-sulfonamide (PubChem CID 103270277) has the molecular formula C11H21NO5S2 and a molecular weight of 311.43 g/mol. Its IUPAC name is N-[(3-hydroxycyclopentyl)methyl]-1,1-dioxothiane-4-sulfonamide.
| Compound Name | N-[(3-hydroxycyclopentyl)methyl]-1,1-dioxothiane-4-sulfonamide |
|---|---|
| PubChem CID | 103270277 |
| Molecular Formula | C11H21NO5S2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N-[(3-hydroxycyclopentyl)methyl]-1,1-dioxothiane-4-sulfonamide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)NCC2CCC(O)C2)CC1 |
| InChI | InChI=1S/C11H21NO5S2/c13-10-2-1-9(7-10)8-12-19(16,17)11-3-5-18(14,15)6-4-11/h9-13H,1-8H2 |
| InChIKey | KXPLJEDRCBPKLX-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |