C12H22ClNO4S2 — CID 106136195
N-[(4-chlorocyclohexyl)methyl]-1,1-dioxothiane-4-sulfonamide (PubChem CID 106136195) has the molecular formula C12H22ClNO4S2 and a molecular weight of 343.90 g/mol. Its IUPAC name is N-[(4-chlorocyclohexyl)methyl]-1,1-dioxothiane-4-sulfonamide.
| Compound Name | N-[(4-chlorocyclohexyl)methyl]-1,1-dioxothiane-4-sulfonamide |
|---|---|
| PubChem CID | 106136195 |
| Molecular Formula | C12H22ClNO4S2 |
| Molecular Weight | 343.90 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | N-[(4-chlorocyclohexyl)methyl]-1,1-dioxothiane-4-sulfonamide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)NCC2CCC(Cl)CC2)CC1 |
| InChI | InChI=1S/C12H22ClNO4S2/c13-11-3-1-10(2-4-11)9-14-20(17,18)12-5-7-19(15,16)8-6-12/h10-12,14H,1-9H2 |
| InChIKey | KZPRLNJKNJEWEH-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.90 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|