C11H20ClNO4S2 — CID 65033187
N-(4-chlorocyclohexyl)-1,1-dioxothiane-4-sulfonamide (PubChem CID 65033187) has the molecular formula C11H20ClNO4S2 and a molecular weight of 329.87 g/mol. Its IUPAC name is N-(4-chlorocyclohexyl)-1,1-dioxothiane-4-sulfonamide.
| Compound Name | N-(4-chlorocyclohexyl)-1,1-dioxothiane-4-sulfonamide |
|---|---|
| PubChem CID | 65033187 |
| Molecular Formula | C11H20ClNO4S2 |
| Molecular Weight | 329.87 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | N-(4-chlorocyclohexyl)-1,1-dioxothiane-4-sulfonamide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)NC2CCC(Cl)CC2)CC1 |
| InChI | InChI=1S/C11H20ClNO4S2/c12-9-1-3-10(4-2-9)13-19(16,17)11-5-7-18(14,15)8-6-11/h9-11,13H,1-8H2 |
| InChIKey | CQEAQROAAISVIR-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.87 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|