C10H20N2O4S2 — CID 63252300
N-(2-aminocyclopentyl)-1,1-dioxothiane-4-sulfonamide (PubChem CID 63252300) has the molecular formula C10H20N2O4S2 and a molecular weight of 296.41 g/mol. Its IUPAC name is N-(2-aminocyclopentyl)-1,1-dioxothiane-4-sulfonamide.
| Compound Name | N-(2-aminocyclopentyl)-1,1-dioxothiane-4-sulfonamide |
|---|---|
| PubChem CID | 63252300 |
| Molecular Formula | C10H20N2O4S2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | N-(2-aminocyclopentyl)-1,1-dioxothiane-4-sulfonamide |
| SMILES | NC1CCCC1NS(=O)(=O)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H20N2O4S2/c11-9-2-1-3-10(9)12-18(15,16)8-4-6-17(13,14)7-5-8/h8-10,12H,1-7,11H2 |
| InChIKey | LDLZNBCVNVWKRK-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |