C9H18N2O4S2 — CID 63251989
N-(2-aminocyclopentyl)-1,1-dioxothiolane-3-sulfonamide (PubChem CID 63251989) has the molecular formula C9H18N2O4S2 and a molecular weight of 282.39 g/mol. Its IUPAC name is N-(2-aminocyclopentyl)-1,1-dioxothiolane-3-sulfonamide.
| Compound Name | N-(2-aminocyclopentyl)-1,1-dioxothiolane-3-sulfonamide |
|---|---|
| PubChem CID | 63251989 |
| Molecular Formula | C9H18N2O4S2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | N-(2-aminocyclopentyl)-1,1-dioxothiolane-3-sulfonamide |
| SMILES | NC1CCCC1NS(=O)(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H18N2O4S2/c10-8-2-1-3-9(8)11-17(14,15)7-4-5-16(12,13)6-7/h7-9,11H,1-6,10H2 |
| InChIKey | RDBKQLGDFUCSDH-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |