C4H7O5S2- — CID 7088081
(3S)-1,1-dioxothiolane-3-sulfonate (PubChem CID 7088081) has the molecular formula C4H7O5S2- and a molecular weight of 199.23 g/mol. Its IUPAC name is (3S)-1,1-dioxothiolane-3-sulfonate.
| Compound Name | (3S)-1,1-dioxothiolane-3-sulfonate |
|---|---|
| PubChem CID | 7088081 |
| Molecular Formula | C4H7O5S2- |
| Molecular Weight | 199.23 g/mol |
| Exact Mass | 198.97 |
| IUPAC Name | (3S)-1,1-dioxothiolane-3-sulfonate |
| SMILES | O=S1(=O)CC[C@H](S(=O)(=O)[O-])C1 |
| InChI | InChI=1S/C4H8O5S2/c5-10(6)2-1-4(3-10)11(7,8)9/h4H,1-3H2,(H,7,8,9)/p-1/t4-/m0/s1 |
| InChIKey | QJJODUDDARIVCQ-BYPYZUCNSA-M |
| XLogP | -1.28 |
| TPSA | 91.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.23 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|