C5H7NO4S3 — CID 42445842
(3R)-1,1-dioxo-N-(sulfanylidenemethylidene)thiolane-3-sulfonamide (PubChem CID 42445842) has the molecular formula C5H7NO4S3 and a molecular weight of 241.31 g/mol. Its IUPAC name is (3R)-1,1-dioxo-N-(sulfanylidenemethylidene)thiolane-3-sulfonamide.
| Compound Name | (3R)-1,1-dioxo-N-(sulfanylidenemethylidene)thiolane-3-sulfonamide |
|---|---|
| PubChem CID | 42445842 |
| Molecular Formula | C5H7NO4S3 |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 240.95 |
| IUPAC Name | (3R)-1,1-dioxo-N-(sulfanylidenemethylidene)thiolane-3-sulfonamide |
| SMILES | O=S1(=O)CC[C@@H](S(=O)(=O)N=C=S)C1 |
| InChI | InChI=1S/C5H7NO4S3/c7-12(8)2-1-5(3-12)13(9,10)6-4-11/h5H,1-3H2/t5-/m1/s1 |
| InChIKey | YVJNHMUQYQTBNC-RXMQYKEDSA-N |
| XLogP | -0.39 |
| TPSA | 80.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|