C6H10F3NO5S2 — CID 82715812
1,1-dioxo-N-(2,2,2-trifluoroethoxy)thiolane-3-sulfonamide (PubChem CID 82715812) has the molecular formula C6H10F3NO5S2 and a molecular weight of 297.28 g/mol. Its IUPAC name is 1,1-dioxo-N-(2,2,2-trifluoroethoxy)thiolane-3-sulfonamide.
| Compound Name | 1,1-dioxo-N-(2,2,2-trifluoroethoxy)thiolane-3-sulfonamide |
|---|---|
| PubChem CID | 82715812 |
| Molecular Formula | C6H10F3NO5S2 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | 1,1-dioxo-N-(2,2,2-trifluoroethoxy)thiolane-3-sulfonamide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)NOCC(F)(F)F)C1 |
| InChI | InChI=1S/C6H10F3NO5S2/c7-6(8,9)4-15-10-17(13,14)5-1-2-16(11,12)3-5/h5,10H,1-4H2 |
| InChIKey | QTHYGULEZQZKGL-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|