C7H15NO5S2 — CID 83058487
N-[(2S)-2-hydroxypropyl]-1,1-dioxothiolane-3-sulfonamide (PubChem CID 83058487) has the molecular formula C7H15NO5S2 and a molecular weight of 257.33 g/mol. Its IUPAC name is N-[(2S)-2-hydroxypropyl]-1,1-dioxothiolane-3-sulfonamide.
| Compound Name | N-[(2S)-2-hydroxypropyl]-1,1-dioxothiolane-3-sulfonamide |
|---|---|
| PubChem CID | 83058487 |
| Molecular Formula | C7H15NO5S2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | N-[(2S)-2-hydroxypropyl]-1,1-dioxothiolane-3-sulfonamide |
| SMILES | C[C@H](O)CNS(=O)(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H15NO5S2/c1-6(9)4-8-15(12,13)7-2-3-14(10,11)5-7/h6-9H,2-5H2,1H3/t6-,7?/m0/s1 |
| InChIKey | VUZLCSZROQCVHU-PKPIPKONSA-N |
| XLogP | -1.53 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |