C9H20N2O5S2 — CID 113430482
N-[2-(2-hydroxypropylamino)ethyl]-1,1-dioxothiolane-3-sulfonamide (PubChem CID 113430482) has the molecular formula C9H20N2O5S2 and a molecular weight of 300.40 g/mol. Its IUPAC name is N-[2-(2-hydroxypropylamino)ethyl]-1,1-dioxothiolane-3-sulfonamide.
| Compound Name | N-[2-(2-hydroxypropylamino)ethyl]-1,1-dioxothiolane-3-sulfonamide |
|---|---|
| PubChem CID | 113430482 |
| Molecular Formula | C9H20N2O5S2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | N-[2-(2-hydroxypropylamino)ethyl]-1,1-dioxothiolane-3-sulfonamide |
| SMILES | CC(O)CNCCNS(=O)(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H20N2O5S2/c1-8(12)6-10-3-4-11-18(15,16)9-2-5-17(13,14)7-9/h8-12H,2-7H2,1H3 |
| InChIKey | ACRYJZRYWSSVBE-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|