C7H16N2O4S2 — CID 62659118
N-[2-(methylamino)ethyl]-1,1-dioxothiolane-3-sulfonamide (PubChem CID 62659118) has the molecular formula C7H16N2O4S2 and a molecular weight of 256.35 g/mol. Its IUPAC name is N-[2-(methylamino)ethyl]-1,1-dioxothiolane-3-sulfonamide.
| Compound Name | N-[2-(methylamino)ethyl]-1,1-dioxothiolane-3-sulfonamide |
|---|---|
| PubChem CID | 62659118 |
| Molecular Formula | C7H16N2O4S2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | N-[2-(methylamino)ethyl]-1,1-dioxothiolane-3-sulfonamide |
| SMILES | CNCCNS(=O)(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H16N2O4S2/c1-8-3-4-9-15(12,13)7-2-5-14(10,11)6-7/h7-9H,2-6H2,1H3 |
| InChIKey | WEUDJLGWIUYFHR-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|