C7H12O6S2 — CID 7361246
methyl 2-[(3S)-1,1-dioxothiolan-3-yl]sulfonylacetate (PubChem CID 7361246) has the molecular formula C7H12O6S2 and a molecular weight of 256.30 g/mol. Its IUPAC name is methyl 2-[(3S)-1,1-dioxothiolan-3-yl]sulfonylacetate.
| Compound Name | methyl 2-[(3S)-1,1-dioxothiolan-3-yl]sulfonylacetate |
|---|---|
| PubChem CID | 7361246 |
| Molecular Formula | C7H12O6S2 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | methyl 2-[(3S)-1,1-dioxothiolan-3-yl]sulfonylacetate |
| SMILES | COC(=O)CS(=O)(=O)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H12O6S2/c1-13-7(8)5-15(11,12)6-2-3-14(9,10)4-6/h6H,2-5H2,1H3/t6-/m0/s1 |
| InChIKey | BXIOUILWECCHQC-LURJTMIESA-N |
| XLogP | -1.24 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |