methyl 2-[(3S)-1,1-dioxothiolan-3-yl]sulfonylacetate

C7H12O6S2 — CID 7361246

IUPACmethyl 2-[(3S)-1,1-dioxothiolan-3-yl]sulfonylacetate
SMILESCOC(=O)CS(=O)(=O)[C@H]1CCS(=O)(=O)C1
InChIInChI=1S/C7H12O6S2/c1-13-7(8)5-15(11,12)6-2-3-14(9,10)4-6/h6H,2-5H2,1H3/t6-/m0/s1
InChIKeyBXIOUILWECCHQC-LURJTMIESA-N
MW256.30 g/mol
LogP-1.24
Rot. Bonds3

About methyl 2-[(3S)-1,1-dioxothiolan-3-yl]sulfonylacetate

methyl 2-[(3S)-1,1-dioxothiolan-3-yl]sulfonylacetate (PubChem CID 7361246) has the molecular formula C7H12O6S2 and a molecular weight of 256.30 g/mol. Its IUPAC name is methyl 2-[(3S)-1,1-dioxothiolan-3-yl]sulfonylacetate.

Molecular Properties

Compound Namemethyl 2-[(3S)-1,1-dioxothiolan-3-yl]sulfonylacetate
PubChem CID7361246
Molecular FormulaC7H12O6S2
Molecular Weight256.30 g/mol
Exact Mass256.01
IUPAC Namemethyl 2-[(3S)-1,1-dioxothiolan-3-yl]sulfonylacetate
SMILESCOC(=O)CS(=O)(=O)[C@H]1CCS(=O)(=O)C1
InChIInChI=1S/C7H12O6S2/c1-13-7(8)5-15(11,12)6-2-3-14(9,10)4-6/h6H,2-5H2,1H3/t6-/m0/s1
InChIKeyBXIOUILWECCHQC-LURJTMIESA-N
XLogP-1.24
TPSA94.58 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.30
LogP ≤ 5-1.24
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 2-[(3S)-1,1-dioxothiolan-3-yl]sulfonylacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(3S)-1,1-dioxothiolan-3-yl]sulfonylacetate?
The IUPAC name of methyl 2-[(3S)-1,1-dioxothiolan-3-yl]sulfonylacetate (CID 7361246) is methyl 2-[(3S)-1,1-dioxothiolan-3-yl]sulfonylacetate.
What is the SMILES notation for methyl 2-[(3S)-1,1-dioxothiolan-3-yl]sulfonylacetate?
The canonical SMILES for methyl 2-[(3S)-1,1-dioxothiolan-3-yl]sulfonylacetate is COC(=O)CS(=O)(=O)[C@H]1CCS(=O)(=O)C1.
What is the InChIKey of methyl 2-[(3S)-1,1-dioxothiolan-3-yl]sulfonylacetate?
The InChIKey is BXIOUILWECCHQC-LURJTMIESA-N. The full InChI is InChI=1S/C7H12O6S2/c1-13-7(8)5-15(11,12)6-2-3-14(9,10)4-6/h6H,2-5H2,1H3/t6-/m0/s1.
What are the key properties of methyl 2-[(3S)-1,1-dioxothiolan-3-yl]sulfonylacetate?
methyl 2-[(3S)-1,1-dioxothiolan-3-yl]sulfonylacetate has a molecular weight of 256.30 g/mol, XLogP of -1.24, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3S)-1,1-dioxothiolan-3-yl]sulfonylacetate is sourced from PubChem (CID 7361246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).