C8H16N2O4S2 — CID 79685893
1,1-dioxo-N-[(3R)-pyrrolidin-3-yl]thiolane-3-sulfonamide (PubChem CID 79685893) has the molecular formula C8H16N2O4S2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 1,1-dioxo-N-[(3R)-pyrrolidin-3-yl]thiolane-3-sulfonamide.
| Compound Name | 1,1-dioxo-N-[(3R)-pyrrolidin-3-yl]thiolane-3-sulfonamide |
|---|---|
| PubChem CID | 79685893 |
| Molecular Formula | C8H16N2O4S2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 1,1-dioxo-N-[(3R)-pyrrolidin-3-yl]thiolane-3-sulfonamide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)N[C@@H]2CCNC2)C1 |
| InChI | InChI=1S/C8H16N2O4S2/c11-15(12)4-2-8(6-15)16(13,14)10-7-1-3-9-5-7/h7-10H,1-6H2/t7-,8?/m1/s1 |
| InChIKey | AIZYVFNSWXIFFL-GVHYBUMESA-N |
| XLogP | -1.55 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |