C5H10F2N2O2S — CID 79685509
1,1-difluoro-N-[(3R)-pyrrolidin-3-yl]methanesulfonamide (PubChem CID 79685509) has the molecular formula C5H10F2N2O2S and a molecular weight of 200.21 g/mol. Its IUPAC name is 1,1-difluoro-N-[(3R)-pyrrolidin-3-yl]methanesulfonamide.
| Compound Name | 1,1-difluoro-N-[(3R)-pyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 79685509 |
| Molecular Formula | C5H10F2N2O2S |
| Molecular Weight | 200.21 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 1,1-difluoro-N-[(3R)-pyrrolidin-3-yl]methanesulfonamide |
| SMILES | O=S(=O)(N[C@@H]1CCNC1)C(F)F |
| InChI | InChI=1S/C5H10F2N2O2S/c6-5(7)12(10,11)9-4-1-2-8-3-4/h4-5,8-9H,1-3H2/t4-/m1/s1 |
| InChIKey | OSLOLQWQECMCQX-SCSAIBSYSA-N |
| XLogP | -0.51 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.21 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |