C6H12F3N3O2S — CID 104978131
(3R)-N-(2,2,2-trifluoroethylsulfamoyl)pyrrolidin-3-amine (PubChem CID 104978131) has the molecular formula C6H12F3N3O2S and a molecular weight of 247.24 g/mol. Its IUPAC name is (3R)-N-(2,2,2-trifluoroethylsulfamoyl)pyrrolidin-3-amine.
| Compound Name | (3R)-N-(2,2,2-trifluoroethylsulfamoyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 104978131 |
| Molecular Formula | C6H12F3N3O2S |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | (3R)-N-(2,2,2-trifluoroethylsulfamoyl)pyrrolidin-3-amine |
| SMILES | O=S(=O)(NCC(F)(F)F)N[C@@H]1CCNC1 |
| InChI | InChI=1S/C6H12F3N3O2S/c7-6(8,9)4-11-15(13,14)12-5-1-2-10-3-5/h5,10-12H,1-4H2/t5-/m1/s1 |
| InChIKey | SGIDADOMBQPGRI-RXMQYKEDSA-N |
| XLogP | -0.67 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |