C10H22N2O2S — CID 103828888
3,3-dimethyl-N-pyrrolidin-3-ylbutane-1-sulfonamide (PubChem CID 103828888) has the molecular formula C10H22N2O2S and a molecular weight of 234.36 g/mol. Its IUPAC name is 3,3-dimethyl-N-pyrrolidin-3-ylbutane-1-sulfonamide.
| Compound Name | 3,3-dimethyl-N-pyrrolidin-3-ylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 103828888 |
| Molecular Formula | C10H22N2O2S |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 3,3-dimethyl-N-pyrrolidin-3-ylbutane-1-sulfonamide |
| SMILES | CC(C)(C)CCS(=O)(=O)NC1CCNC1 |
| InChI | InChI=1S/C10H22N2O2S/c1-10(2,3)5-7-15(13,14)12-9-4-6-11-8-9/h9,11-12H,4-8H2,1-3H3 |
| InChIKey | WIGLOZILAJYKMH-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |