C12H26N2O2S — CID 103828982
3,3-dimethyl-N-(2-pyrrolidin-3-ylethyl)butane-1-sulfonamide (PubChem CID 103828982) has the molecular formula C12H26N2O2S and a molecular weight of 262.42 g/mol. Its IUPAC name is 3,3-dimethyl-N-(2-pyrrolidin-3-ylethyl)butane-1-sulfonamide.
| Compound Name | 3,3-dimethyl-N-(2-pyrrolidin-3-ylethyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 103828982 |
| Molecular Formula | C12H26N2O2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 3,3-dimethyl-N-(2-pyrrolidin-3-ylethyl)butane-1-sulfonamide |
| SMILES | CC(C)(C)CCS(=O)(=O)NCCC1CCNC1 |
| InChI | InChI=1S/C12H26N2O2S/c1-12(2,3)6-9-17(15,16)14-8-5-11-4-7-13-10-11/h11,13-14H,4-10H2,1-3H3 |
| InChIKey | SJVZTGFMZFICOF-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |