C10H20N2O4S — CID 55249778
4-(2-pyrrolidin-3-ylethylsulfamoyl)butanoic acid (PubChem CID 55249778) has the molecular formula C10H20N2O4S and a molecular weight of 264.35 g/mol. Its IUPAC name is 4-(2-pyrrolidin-3-ylethylsulfamoyl)butanoic acid.
| Compound Name | 4-(2-pyrrolidin-3-ylethylsulfamoyl)butanoic acid |
|---|---|
| PubChem CID | 55249778 |
| Molecular Formula | C10H20N2O4S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 4-(2-pyrrolidin-3-ylethylsulfamoyl)butanoic acid |
| SMILES | O=C(O)CCCS(=O)(=O)NCCC1CCNC1 |
| InChI | InChI=1S/C10H20N2O4S/c13-10(14)2-1-7-17(15,16)12-6-4-9-3-5-11-8-9/h9,11-12H,1-8H2,(H,13,14) |
| InChIKey | UXYRAXTUSKPWDJ-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |