C10H18N2O5S — CID 79394848
4-[[3-(cyclopropylamino)-3-oxopropyl]sulfamoyl]butanoic acid (PubChem CID 79394848) has the molecular formula C10H18N2O5S and a molecular weight of 278.33 g/mol. Its IUPAC name is 4-[[3-(cyclopropylamino)-3-oxopropyl]sulfamoyl]butanoic acid.
| Compound Name | 4-[[3-(cyclopropylamino)-3-oxopropyl]sulfamoyl]butanoic acid |
|---|---|
| PubChem CID | 79394848 |
| Molecular Formula | C10H18N2O5S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 4-[[3-(cyclopropylamino)-3-oxopropyl]sulfamoyl]butanoic acid |
| SMILES | O=C(O)CCCS(=O)(=O)NCCC(=O)NC1CC1 |
| InChI | InChI=1S/C10H18N2O5S/c13-9(12-8-3-4-8)5-6-11-18(16,17)7-1-2-10(14)15/h8,11H,1-7H2,(H,12,13)(H,14,15) |
| InChIKey | PDSKTIALEXWLBJ-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |