C14H23N3O4S2 — CID 119977448
N-[2-(2-pyrrolidin-3-ylethylsulfamoyl)ethyl]benzenesulfonamide (PubChem CID 119977448) has the molecular formula C14H23N3O4S2 and a molecular weight of 361.49 g/mol. Its IUPAC name is N-[2-(2-pyrrolidin-3-ylethylsulfamoyl)ethyl]benzenesulfonamide.
| Compound Name | N-[2-(2-pyrrolidin-3-ylethylsulfamoyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 119977448 |
| Molecular Formula | C14H23N3O4S2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | N-[2-(2-pyrrolidin-3-ylethylsulfamoyl)ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(CCNS(=O)(=O)c1ccccc1)NCCC1CCNC1 |
| InChI | InChI=1S/C14H23N3O4S2/c18-22(19,16-9-7-13-6-8-15-12-13)11-10-17-23(20,21)14-4-2-1-3-5-14/h1-5,13,15-17H,6-12H2 |
| InChIKey | SHZXHMJKCRUMLT-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |