C14H29NO2S — CID 99810517
N-[(1R,3S)-3-ethylcyclohexyl]-3,3-dimethylbutane-1-sulfonamide (PubChem CID 99810517) has the molecular formula C14H29NO2S and a molecular weight of 275.46 g/mol. Its IUPAC name is N-[(1R,3S)-3-ethylcyclohexyl]-3,3-dimethylbutane-1-sulfonamide.
| Compound Name | N-[(1R,3S)-3-ethylcyclohexyl]-3,3-dimethylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 99810517 |
| Molecular Formula | C14H29NO2S |
| Molecular Weight | 275.46 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | N-[(1R,3S)-3-ethylcyclohexyl]-3,3-dimethylbutane-1-sulfonamide |
| SMILES | CC[C@H]1CCC[C@@H](NS(=O)(=O)CCC(C)(C)C)C1 |
| InChI | InChI=1S/C14H29NO2S/c1-5-12-7-6-8-13(11-12)15-18(16,17)10-9-14(2,3)4/h12-13,15H,5-11H2,1-4H3/t12-,13+/m0/s1 |
| InChIKey | ZRIYEVHBEQEMPV-QWHCGFSZSA-N |
| XLogP | 3.31 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |