C9H18N2O4S2 — CID 79686071
1,1-dioxo-N-[(3R)-pyrrolidin-3-yl]thiane-4-sulfonamide (PubChem CID 79686071) has the molecular formula C9H18N2O4S2 and a molecular weight of 282.39 g/mol. Its IUPAC name is 1,1-dioxo-N-[(3R)-pyrrolidin-3-yl]thiane-4-sulfonamide.
| Compound Name | 1,1-dioxo-N-[(3R)-pyrrolidin-3-yl]thiane-4-sulfonamide |
|---|---|
| PubChem CID | 79686071 |
| Molecular Formula | C9H18N2O4S2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 1,1-dioxo-N-[(3R)-pyrrolidin-3-yl]thiane-4-sulfonamide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)N[C@@H]2CCNC2)CC1 |
| InChI | InChI=1S/C9H18N2O4S2/c12-16(13)5-2-9(3-6-16)17(14,15)11-8-1-4-10-7-8/h8-11H,1-7H2/t8-/m1/s1 |
| InChIKey | USRBZAXMQYWUFI-MRVPVSSYSA-N |
| XLogP | -1.16 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |