C11H22N2O4S2 — CID 62083890
N-(2-aminocyclohexyl)-1,1-dioxothiane-4-sulfonamide (PubChem CID 62083890) has the molecular formula C11H22N2O4S2 and a molecular weight of 310.44 g/mol. Its IUPAC name is N-(2-aminocyclohexyl)-1,1-dioxothiane-4-sulfonamide.
| Compound Name | N-(2-aminocyclohexyl)-1,1-dioxothiane-4-sulfonamide |
|---|---|
| PubChem CID | 62083890 |
| Molecular Formula | C11H22N2O4S2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | N-(2-aminocyclohexyl)-1,1-dioxothiane-4-sulfonamide |
| SMILES | NC1CCCCC1NS(=O)(=O)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H22N2O4S2/c12-10-3-1-2-4-11(10)13-19(16,17)9-5-7-18(14,15)8-6-9/h9-11,13H,1-8,12H2 |
| InChIKey | OTTMJZDAHBUQCX-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |