C7H13Cl3N2O2S — CID 18350596
N-(2-aminocyclohexyl)-1,1,1-trichloromethanesulfonamide (PubChem CID 18350596) has the molecular formula C7H13Cl3N2O2S and a molecular weight of 295.62 g/mol. Its IUPAC name is N-(2-aminocyclohexyl)-1,1,1-trichloromethanesulfonamide.
| Compound Name | N-(2-aminocyclohexyl)-1,1,1-trichloromethanesulfonamide |
|---|---|
| PubChem CID | 18350596 |
| Molecular Formula | C7H13Cl3N2O2S |
| Molecular Weight | 295.62 g/mol |
| Exact Mass | 293.98 |
| IUPAC Name | N-(2-aminocyclohexyl)-1,1,1-trichloromethanesulfonamide |
| SMILES | NC1CCCCC1NS(=O)(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C7H13Cl3N2O2S/c8-7(9,10)15(13,14)12-6-4-2-1-3-5(6)11/h5-6,12H,1-4,11H2 |
| InChIKey | KVDUPTMWADDALF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.62 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|