C13H19N3O4S — CID 86814144
N-[(1R,2R)-2-aminocycloheptyl]-4-nitrobenzenesulfonamide (PubChem CID 86814144) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is N-[(1R,2R)-2-aminocycloheptyl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[(1R,2R)-2-aminocycloheptyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 86814144 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | N-[(1R,2R)-2-aminocycloheptyl]-4-nitrobenzenesulfonamide |
| SMILES | N[C@@H]1CCCCC[C@H]1NS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H19N3O4S/c14-12-4-2-1-3-5-13(12)15-21(19,20)11-8-6-10(7-9-11)16(17)18/h6-9,12-13,15H,1-5,14H2/t12-,13-/m1/s1 |
| InChIKey | SDAPRFSUHYCICA-CHWSQXEVSA-N |
| XLogP | 1.53 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|