C20H23N3O6S — CID 177357731
benzyl N-[(1S,2S)-2-[(4-nitrophenyl)sulfonylamino]cyclohexyl]carbamate (PubChem CID 177357731) has the molecular formula C20H23N3O6S and a molecular weight of 433.49 g/mol. Its IUPAC name is benzyl N-[(1S,2S)-2-[(4-nitrophenyl)sulfonylamino]cyclohexyl]carbamate.
| Compound Name | benzyl N-[(1S,2S)-2-[(4-nitrophenyl)sulfonylamino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 177357731 |
| Molecular Formula | C20H23N3O6S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | benzyl N-[(1S,2S)-2-[(4-nitrophenyl)sulfonylamino]cyclohexyl]carbamate |
| SMILES | O=C(N[C@H]1CCCC[C@@H]1NS(=O)(=O)c1ccc([N+](=O)[O-])cc1)OCc1ccccc1 |
| InChI | InChI=1S/C20H23N3O6S/c24-20(29-14-15-6-2-1-3-7-15)21-18-8-4-5-9-19(18)22-30(27,28)17-12-10-16(11-13-17)23(25)26/h1-3,6-7,10-13,18-19,22H,4-5,8-9,14H2,(H,21,24)/t18-,19-/m0/s1 |
| InChIKey | FRVOTYCEASGYLY-OALUTQOASA-N |
| XLogP | 3.11 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|