C16H20BrNO3 — CID 104701403
benzyl N-[2-(2-bromoacetyl)cyclohexyl]carbamate (PubChem CID 104701403) has the molecular formula C16H20BrNO3 and a molecular weight of 354.24 g/mol. Its IUPAC name is benzyl N-[2-(2-bromoacetyl)cyclohexyl]carbamate.
| Compound Name | benzyl N-[2-(2-bromoacetyl)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 104701403 |
| Molecular Formula | C16H20BrNO3 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | benzyl N-[2-(2-bromoacetyl)cyclohexyl]carbamate |
| SMILES | O=C(NC1CCCCC1C(=O)CBr)OCc1ccccc1 |
| InChI | InChI=1S/C16H20BrNO3/c17-10-15(19)13-8-4-5-9-14(13)18-16(20)21-11-12-6-2-1-3-7-12/h1-3,6-7,13-14H,4-5,8-11H2,(H,18,20) |
| InChIKey | BXDKATHESRVFAE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|